Dinoterb structure
|
Common Name | Dinoterb | ||
|---|---|---|---|---|
| CAS Number | 1420-07-1 | Molecular Weight | 240.213 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 304.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H12N2O5 | Melting Point | 125.5-126.5ºC | |
| MSDS | Chinese USA | Flash Point | 125.0±16.3 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | dinoterb |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.2±42.0 °C at 760 mmHg |
| Melting Point | 125.5-126.5ºC |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.213 |
| Flash Point | 125.0±16.3 °C |
| Exact Mass | 240.074615 |
| PSA | 111.87000 |
| LogP | 3.42 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | IIPZYDQGBIWLBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H311-H360D-H410 |
| Supplemental HS | Risk of explosion if heated under confinement. |
| Precautionary Statements | P201-P264-P273-P280-P301 + P310-P308 + P313 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Phrases | 61-24-28-44-50/53 |
| Safety Phrases | 53-45-60-61 |
| RIDADR | 2779 |
| WGK Germany | 3 |
| RTECS | SK0160000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2908999024 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999024 |
|---|---|
| Summary | 2908999024 2-(tert-butyl)-4,6-dinitrophenol。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:5.5%。general tariff:30.0% |
|
Differential pulse adsorptive stripping voltammetric determination of dinoseb and dinoterb at a modified electrode.
Anal. Sci. 19(4) , 511-6, (2003) A sensitive adsorptive stripping voltammetric method for the determination of dinitrophenolic herbicides, dinoseb (DSB) and dinoterb (DTB) at a bare carbon paste electrode (CPE) and a clay modified ca... |
|
|
[Use of the analytical method LC-MS/MS for finding dinoseb and dinoterb in agricultural products, livestock products and seafood].
Shokuhin Eiseigaku Zasshi 54(1) , 1-6, (2013) A simple determination method of dinoseb and dinoterb in agricultural products, livestock products and seafood by LC-MS/MS was developed. Agricultural samples were extracted with acetone (in the case ... |
|
|
Evaluation of a TiO2 photocatalysis treatment on nitrophenols and nitramines contaminated plant wastewaters by solid-phase extraction coupled with ESI HPLC-MS.
J. Hazard. Mater. 166(1) , 284-90, (2009) Nitration reactions of aromatic compounds are commonly involved in different industrial processes for pharmaceutical, pesticide or military uses. For many years, most of the manufacturing sites used l... |
| 2-(TERT-BUTYL)-4,6-DINITROPHENOL |
| Dinoterb |
| Herbogil |
| Dinoterb PESTANAL(R),analytical standard |
| 2-(1,1-dimethylethyl)-4,6-dinitrophenol |
| 2-tert-butyl-4,6-dinitrophenol |
| Dntbp |
| EINECS 215-813-8 |
| 2,4-dinitro-6-tert-butylphenol |
| Dinoterbe |
| MFCD00031117 |
| Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro- |
| Caswell No. 392F |
| Stirpan forte |
| 2-t-butyl-4,6-dinitrophenol |
| Phenol,2-tert-butyl-4,6-dinitro |
| 2-(2-Methyl-2-propanyl)-4,6-dinitrophenol |