CHEMBRDG-BB 5876317 structure
|
Common Name | CHEMBRDG-BB 5876317 | ||
|---|---|---|---|---|
| CAS Number | 85633-96-1 | Molecular Weight | 271.65400 | |
| Density | 1.435g/cm3 | Boiling Point | 447.2ºC at 760 mmHg | |
| Molecular Formula | C11H10ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | 4-(4-chloro-3-nitrophenyl)-3-methyl-4-oxobutanoic acid() |
|---|
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 447.2ºC at 760 mmHg |
| Molecular Formula | C11H10ClNO5 |
| Molecular Weight | 271.65400 |
| Flash Point | 224.3ºC |
| Exact Mass | 271.02500 |
| PSA | 100.19000 |
| LogP | 3.06490 |
| Index of Refraction | 1.581 |
| InChIKey | ZDGKTISONWFCDF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2918300090 |
|---|
|
~96%
CHEMBRDG-BB 5876317 CAS#:85633-96-1 |
| Literature: Jonas, R; Klockow, M; Lues, I; Pruecher, H; Schliep, H J; Wurziger, H European Journal of Medicinal Chemistry, 1993 , vol. 28, # 2 p. 129 - 140 |
|
~%
CHEMBRDG-BB 5876317 CAS#:85633-96-1 |
| Literature: Jonas, R; Klockow, M; Lues, I; Pruecher, H; Schliep, H J; Wurziger, H European Journal of Medicinal Chemistry, 1993 , vol. 28, # 2 p. 129 - 140 |
|
~%
CHEMBRDG-BB 5876317 CAS#:85633-96-1 |
| Literature: Jonas, R; Klockow, M; Lues, I; Pruecher, H; Schliep, H J; Wurziger, H European Journal of Medicinal Chemistry, 1993 , vol. 28, # 2 p. 129 - 140 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |