1H-Benzimidazole,6-chloro-2-(2-chlorophenyl)- structure
|
Common Name | 1H-Benzimidazole,6-chloro-2-(2-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 14225-75-3 | Molecular Weight | 263.12200 | |
| Density | 1.427g/cm3 | Boiling Point | 457.3ºC at 760mmHg | |
| Molecular Formula | C13H8Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8ºC | |
| Name | 5-chloro-2-(2-chloro-phenyl)-1h-benzoimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 457.3ºC at 760mmHg |
| Molecular Formula | C13H8Cl2N2 |
| Molecular Weight | 263.12200 |
| Flash Point | 262.8ºC |
| Exact Mass | 262.00600 |
| PSA | 28.68000 |
| LogP | 4.53670 |
| Vapour Pressure | 1.5E-08mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | MPTBPLMLCWMQGI-UHFFFAOYSA-N |
| SMILES | Clc1ccc2nc(-c3ccccc3Cl)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
1H-Benzimidazol... CAS#:14225-75-3 |
| Literature: Rao; Ratnam Proceedings - Indian Academy of Sciences, Section A, 1958 , # 48 p. 256,258, 260 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<Chloracetyl-N-methylamino>-5-chlor-benzophenon |
| N-methyl 2'-benzoyl-2,4'-dichloroacetanilide |