1H-Benzimidazole, 6-chloro-2-(trichloromethyl)- structure
|
Common Name | 1H-Benzimidazole, 6-chloro-2-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3584-66-5 | Molecular Weight | 269.94300 | |
| Density | 1.704 g/cm3 | Boiling Point | 380.3ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl4N2 | Melting Point | 223-224ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.7ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 6-chloro-2-(trichloromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.704 g/cm3 |
|---|---|
| Boiling Point | 380.3ºC at 760 mmHg |
| Melting Point | 223-224ºC (dec.)(lit.) |
| Molecular Formula | C8H4Cl4N2 |
| Molecular Weight | 269.94300 |
| Flash Point | 215.7ºC |
| Exact Mass | 267.91300 |
| PSA | 28.68000 |
| LogP | 4.04300 |
| Index of Refraction | 1.69 |
| InChIKey | SIZGSKQSWJIWFP-UHFFFAOYSA-N |
| SMILES | Clc1ccc2nc(C(Cl)(Cl)Cl)[nH]c2c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315-H319-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xi: Irritant;T: Toxic; |
| Risk Phrases | R23/24/25 |
| Safety Phrases | 22-26-36/37/39-45 24 25 |
| RIDADR | UN 2811 6 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Designing small-molecule switches for protein-protein interactions.
Science 288(5473) , 2042-5, (2000) Mutations introduced into human growth hormone (hGH) (Thr175 --> Gly-hGH) and the extracellular domain of the hGH receptor (Trp104 --> Gly-hGHbp) created a cavity at the protein-protein interface that... |
| MFCD00005595 |
| EINECS 222-713-8 |
| 5-chloro-2-trichloromethyl-1H-benzoimidazole |
| 5-chloro-2-trichloromethyl-benzimidazole |
| 5-Chloro-2-(trichloromethyl)benzimidazole |