o-fluoranil structure
|
Common Name | o-fluoranil | ||
|---|---|---|---|---|
| CAS Number | 1423-12-7 | Molecular Weight | 180.05700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | o-fluoranil |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F4O2 |
|---|---|
| Molecular Weight | 180.05700 |
| Exact Mass | 179.98300 |
| PSA | 34.14000 |
| LogP | 1.43940 |
| InChIKey | KBZDJUHYRBFGDL-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)C(F)=C(F)C(F)=C1F |
| HS Code | 2914700090 |
|---|
|
~%
o-fluoranil CAS#:1423-12-7 |
| Literature: Sah,P.P.T.; Peoples,S.A. Arzneimittel Forschung, 1961 , vol. 11, # 1 p. 27 - 33 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| tetrahydrobenzindole |
| tetrafluoro-o-benzouinone |
| tetrafluoro-o-benzoquinone |
| ortho-fluoroanil |
| tetrafluoro-1,2-benzoquinone |
| tetrafluoro-o-quinone |