2-[Chloro(4-chlorophenyl)methyl]pyridine structure
|
Common Name | 2-[Chloro(4-chlorophenyl)methyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 142404-69-1 | Molecular Weight | 238.113 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 338.7±32.0 °C at 760 mmHg | |
| Molecular Formula | C12H9Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1±10.7 °C | |
| Name | 2-(Chloro(4-chlorophenyl)methyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.7±32.0 °C at 760 mmHg |
| Molecular Formula | C12H9Cl2N |
| Molecular Weight | 238.113 |
| Flash Point | 189.1±10.7 °C |
| Exact Mass | 237.011200 |
| PSA | 12.89000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | JJOZASAAOCISAR-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(Cl)c2ccccn2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
2-[Chloro(4-chl... CAS#:142404-69-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 6 p. 877 - 893 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[Chloro(4-chlorophenyl)methyl]pyridine |
| Pyridine, 2-[chloro(4-chlorophenyl)methyl]- |
| 2-[chloro-(4-chlorophenyl)methyl]pyridine |
| 2-(4,ALPHA-DICHLOROBENZYL)PYRIDINE |