2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine structure
|
Common Name | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 122368-54-1 | Molecular Weight | 302.799 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 421.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.8±28.7 °C | |
| Name | 2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.7±45.0 °C at 760 mmHg |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.799 |
| Flash Point | 208.8±28.7 °C |
| Exact Mass | 302.118591 |
| PSA | 34.15000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | OTZYADIPHOGUDN-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(OC2CCNCC2)c2ccccn2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
2-[(4-Chlorophe... CAS#:122368-54-1 |
| Literature: US2014/46068 A1, ; Paragraph 0039; 0042; 0043; 0044; 0045; 0046; 0047 ; |
|
~%
2-[(4-Chlorophe... CAS#:122368-54-1 |
| Literature: Bulletin of the Korean Chemical Society, , vol. 34, # 2 p. 549 - 552 |
|
~%
2-[(4-Chlorophe... CAS#:122368-54-1 |
| Literature: Bulletin of the Korean Chemical Society, , vol. 34, # 2 p. 549 - 552 |
|
~%
2-[(4-Chlorophe... CAS#:122368-54-1 |
| Literature: US2014/46068 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2-[(4-chlorophenyl)(4-piperidinyloxy)methyl]- |
| 2-[(4-chlorophenyl)(piperidin-4-yloxy)methyl]pyridine |
| 2-[(4-Chlorphenyl)(piperidin-4-yloxy)methyl]pyridin |
| 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine |
| 2-[(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine |