Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine structure
|
Common Name | Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine | ||
|---|---|---|---|---|
| CAS Number | 142421-57-6 | Molecular Weight | 492.62600 | |
| Density | N/A | Boiling Point | 333.2ºC at 760mmHg | |
| Molecular Formula | C16H6ClF12P | Melting Point | 25-29ºC | |
| MSDS | Chinese USA | Flash Point | 155.3ºC | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 333.2ºC at 760mmHg |
|---|---|
| Melting Point | 25-29ºC |
| Molecular Formula | C16H6ClF12P |
| Molecular Weight | 492.62600 |
| Flash Point | 155.3ºC |
| Exact Mass | 491.97000 |
| PSA | 13.59000 |
| LogP | 7.34830 |
| Appearance of Characters | liquid | colorless |
| Vapour Pressure | 0.000269mmHg at 25°C |
| InChIKey | DFZQEHBNAJGDCT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(P(Cl)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| Water Solubility | Reacts with water. |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H261-H314 |
| Precautionary Statements | P231 + P232-P280-P305 + P351 + P338-P310-P422 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | R14 |
| Safety Phrases | S26 |
| RIDADR | UN3265 |
| Packaging Group | II |
|
~%
Bis(3,5-di(trif... CAS#:142421-57-6 |
| Literature: Journal of the American Chemical Society, , vol. 116, # 22 p. 9869 - 9882 |
|
~57%
Bis(3,5-di(trif... CAS#:142421-57-6 |
| Literature: Bonnaventure, Isabelle; Charette, Andre B. Journal of Organic Chemistry, 2008 , vol. 73, # 16 p. 6330 - 6340 |
|
~%
Bis(3,5-di(trif... CAS#:142421-57-6 |
| Literature: Organic Letters, , vol. 6, # 25 p. 4675 - 4678 |
|
~%
Bis(3,5-di(trif... CAS#:142421-57-6 |
| Literature: Journal of the American Chemical Society, , vol. 116, # 22 p. 9869 - 9882 |
| P,P-Bis[3,5-bis(trifluoromethyl)phenyl]phosphinous chloride |
| Chlorobis[3,5-bis(trifluoromethyl)phenyl]phosphine |
| bis[3,5-bis(trifluoromethyl)phenyl]-chlorophosphane |
| MFCD01630852 |