Sp-5,6-dichloro-cBIMPS (sodium salt) structure
|
Common Name | Sp-5,6-dichloro-cBIMPS (sodium salt) | ||
|---|---|---|---|---|
| CAS Number | 142439-96-1 | Molecular Weight | 419.153 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10Cl2N2NaO5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sp-5,6-dichloro-cBIMPS (sodium salt)Sp-5,6-dichloro-cBIMPS is a benzimidazole monophosphorothioate that acts as a potent activator of protein kinase A (PKA; Ki = 30 nM).1 It is selective for PKA over PKG (Ki = 10 M). |
| Name | Sp-5,6-dichloro-cBIMPS (sodium salt) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10Cl2N2NaO5PS |
|---|---|
| Molecular Weight | 419.153 |
| Exact Mass | 417.932281 |
| InChIKey | LXTHVPHQPNCKKG-MOBMELGVSA-M |
| SMILES | [Na+].[O-]P1(=S)OCC2OC(n3cnc4cc(Cl)c(Cl)cc43)C(O)C2O1 |
| Sp-5,6-dichloro-cBIMPS (sodium salt) |
| Sp 5,6-DCl-cBIMPS |
| 4H-Furo[3,2-d]-1,3,2-dioxaphosphorin-7-ol, 6-(5,6-dichloro-1H-benzimidazol-1-yl)tetrahydro-2-mercapto-, 2-oxide, sodium salt, (2S,4aR,6R,7R,7aS)- (1:1) |
| Sodium (2S,4aR,6R,7R,7aS)-6-(5,6-dichloro-1H-benzimidazol-1-yl)-7-hydroxytetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinine-2-thiolate 2-oxide |
| MFCD04037246 |
| 5,6-Dichloro-1-b-D-ribofuranosylbenzimidazole-3',5'-cyclic monophosphorothioate, Sp- isomer sodium salt |
| MFCD06795834 |
| Sp-5,6-DCl-cBIMPS |