1-(4-Benzyloxyphenyl)-3-phenyl-1,3-propanedione structure
|
Common Name | 1-(4-Benzyloxyphenyl)-3-phenyl-1,3-propanedione | ||
|---|---|---|---|---|
| CAS Number | 142472-13-7 | Molecular Weight | 330.37700 | |
| Density | 1.173g/cm3 | Boiling Point | 524.6ºC at 760mmHg | |
| Molecular Formula | C22H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | 1-phenyl-3-(4-phenylmethoxyphenyl)propane-1,3-dione |
|---|
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 524.6ºC at 760mmHg |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.37700 |
| Flash Point | 230.9ºC |
| Exact Mass | 330.12600 |
| PSA | 43.37000 |
| LogP | 4.72130 |
| Vapour Pressure | 4.25E-11mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | IMICPPMXUFKEQQ-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccc(OCc2ccccc2)cc1)c1ccccc1 |
|
~53%
1-(4-Benzyloxyp... CAS#:142472-13-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 4 p. 1047 - 1049 |
|
~%
1-(4-Benzyloxyp... CAS#:142472-13-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 4 p. 1047 - 1049 |
|
~%
1-(4-Benzyloxyp... CAS#:142472-13-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 4 p. 1047 - 1049 |