pongamol structure
|
Common Name | pongamol | ||
|---|---|---|---|---|
| CAS Number | 484-33-3 | Molecular Weight | 294.30 | |
| Density | 1.236 g/cm3 | Boiling Point | 448.7ºC at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | 126-130ºC | |
| MSDS | N/A | Flash Point | 218.7ºC | |
Use of pongamolPongamol (Lanceolatin C) is potent α-glucosidase inhibitor (IC50=103.5 μM) and has free-radical (DPPH) scavenging,antihyperglycemic, and antihyperglycemic activities[1]. |
| Name | pongamol |
|---|---|
| Synonym | More Synonyms |
| Description | Pongamol (Lanceolatin C) is potent α-glucosidase inhibitor (IC50=103.5 μM) and has free-radical (DPPH) scavenging,antihyperglycemic, and antihyperglycemic activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.236 g/cm3 |
|---|---|
| Boiling Point | 448.7ºC at 760 mmHg |
| Melting Point | 126-130ºC |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30 |
| Flash Point | 218.7ºC |
| Exact Mass | 294.08900 |
| PSA | 56.51000 |
| LogP | 3.89710 |
| Vapour Pressure | 3.02E-10mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | XTLSKKJNOIMMBK-UHFFFAOYSA-N |
| SMILES | COc1c(C(=O)CC(=O)c2ccccc2)ccc2occc12 |
|
~%
pongamol CAS#:484-33-3 |
| Literature: Mukerjee; Seshadri Journal of the Chemical Society, 1955 , p. 2048 |
| 1-(4-METHOXY-5-BENZOFURANYL)-3-PHENYL-1,3-PROPANEDIONE |
| 1-(4-methoxy-benzofuran-5-yl)-3-phenyl-propane-1,3-dione |
| 1-(4-Methoxy-benzofuran-5-yl)-3-phenyl-propan-1,3-dion |
| pongamiaextract,pongamol |
| 1-(4-Methoxybenzofuran-5-yl)-3-phenyl-1,3-propanedione |
| pongamolfrompongamiaglabrafruits |