Z-Dap(Fmoc)-OH structure
|
Common Name | Z-Dap(Fmoc)-OH | ||
|---|---|---|---|---|
| CAS Number | 142855-80-9 | Molecular Weight | 446.495 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 666.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H26N2O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 356.6±31.5 °C | |
| Name | (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(((benzyloxy)methyl)amino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 666.0±55.0 °C at 760 mmHg |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.495 |
| Flash Point | 356.6±31.5 °C |
| Exact Mass | 446.184174 |
| PSA | 96.89000 |
| LogP | 5.85 |
| Appearance of Characters | Powder | White |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | MVKNXKRRMCSKJJ-QHCPKHFHSA-N |
| SMILES | O=C(NCC(NC(=O)OCc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | Store at 0°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
Z-Dap(Fmoc)-OH CAS#:142855-80-9 |
| Literature: Tetrahedron Letters, , vol. 34, # 28 p. 4493 - 4496 |
|
~94%
Z-Dap(Fmoc)-OH CAS#:142855-80-9 |
| Literature: Marrano; de Macedo; Gagnon; Lapierre; Gravel; Keillor Bioorganic and medicinal chemistry, 2001 , vol. 9, # 12 p. 3231 - 3241 |
|
~%
Z-Dap(Fmoc)-OH CAS#:142855-80-9 |
| Literature: Tetrahedron Letters, , vol. 34, # 28 p. 4493 - 4496 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(phenylmethoxymethylamino)propanoic acid |
| L-Alanine, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-N-[(phenylmethoxy)methyl]- |
| N-[(Benzyloxy)methyl]-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-L-alanine |
| Z-Dap(Fmoc)-OH |