2-(5-bromo-2-pyridylazo)-5-diethylaminophenol structure
|
Common Name | 2-(5-bromo-2-pyridylazo)-5-diethylaminophenol | ||
|---|---|---|---|---|
| CAS Number | 14337-53-2 | Molecular Weight | 349.226 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 511.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H17BrN4O | Melting Point | 155-160 °C | |
| MSDS | Chinese USA | Flash Point | 262.9±30.1 °C | |
| Name | 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.1±50.0 °C at 760 mmHg |
| Melting Point | 155-160 °C |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.226 |
| Flash Point | 262.9±30.1 °C |
| Exact Mass | 348.058563 |
| PSA | 61.08000 |
| LogP | 4.42 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | HNVCXDAVEHOIBP-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2ccc(Br)cn2)c(O)c1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S24/25-S22 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[2-(5-bromo-2-pyridyl)diaz-1-enyl]-5-(diethylamino)phenol |
| 2-((5-Bromopyridin-2-yl)diazenyl)-5-(diethylamino)phenol |
| 5-diethylamino-2-(5-bromo-2-pyridylazo)phenol |
| 2-[(E)-(5-Bromo-2-pyridinyl)diazenyl]-5-(diethylamino)phenol |
| 2-(5-bromo-2-pyridylazo)-5-diethylaminophenol |
| Bromo-PADAP |
| Phenol, 2-[(5-bromo-2-pyridinyl)azo]-5-(diethylamino)- |
| 2-[(E)-(5-Bromopyridin-2-yl)diazenyl]-5-(diethylamino)phenol |
| MFCD00006255 |
| 2-(4-Diethylamino-2-hydroxyphenylazo)-5-bromopyridine |
| 2-(5-BROMO-2-PYRIDYLAZO)-5-(DIETHYLAMINO)PHENOL |
| Phenol, 2-[(E)-2-(5-bromo-2-pyridinyl)diazenyl]-5-(diethylamino)- |
| EINECS 238-286-6 |
| 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)-phenol |