tert-Butyl (3-iodophenyl)carbamate structure
|
Common Name | tert-Butyl (3-iodophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 143390-49-2 | Molecular Weight | 319.139 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 303.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H14INO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 137.4±23.2 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | tert-butyl N-(3-iodophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.5±25.0 °C at 760 mmHg |
| Molecular Formula | C11H14INO2 |
| Molecular Weight | 319.139 |
| Flash Point | 137.4±23.2 °C |
| Exact Mass | 319.006927 |
| PSA | 38.33000 |
| LogP | 4.42 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | MPCQRNOVFYBCTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(I)c1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2924299090 |
|
~77%
tert-Butyl (3-i... CAS#:143390-49-2 |
| Literature: Macdonald, Gregor; Lewis, Norman J.; Taylor, Richard J. K. Chemical Communications, 1996 , # 23 p. 2647 - 2648 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-Butyl (3-iodophenyl)carbamate |
| (3-Iodo-phenyl)-carbamic acid tert-; butyl ester |
| N-BOC 3-IODOANILINE |
| butyl ester |
| N-(3-Iodophenyl)-1,1-dimethylethyl Ester Carbamic Acid |
| Carbamic acid, N-(3-iodophenyl)-, 1,1-dimethylethyl ester |
| 3-iodo-N-Boc-aniline |
| 2-Methyl-2-propanyl (3-iodophenyl)carbamate |
| N-Boc-3-iodoaniline |
| N-tert-butoxycarbonyl-3-iodoaniline |