Landiolol Hydrochloride structure
|
Common Name | Landiolol Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 144481-98-1 | Molecular Weight | 546.053 | |
| Density | 1.201g/cm3 | Boiling Point | 727.5ºC at 760mmHg | |
| Molecular Formula | C25H40ClN3O8 | Melting Point | 122-127ºC | |
| MSDS | N/A | Flash Point | 393.8ºC | |
Use of Landiolol HydrochlorideLandiolol hydrochloride (ONO1101 hydrochloride) is a highly beta1 selective ultra-short acting beta-blocker (β1/β2 selectivity = 255:1, a half-life of 4 min), acts as an adrenoceptor antagonist[1]. |
| Name | Landiolol hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Landiolol hydrochloride (ONO1101 hydrochloride) is a highly beta1 selective ultra-short acting beta-blocker (β1/β2 selectivity = 255:1, a half-life of 4 min), acts as an adrenoceptor antagonist[1]. |
|---|---|
| Related Catalog | |
| Target |
beta-adrenergic receptor[1] |
| References |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 727.5ºC at 760mmHg |
| Melting Point | 122-127ºC |
| Molecular Formula | C25H40ClN3O8 |
| Molecular Weight | 546.053 |
| Flash Point | 393.8ºC |
| Exact Mass | 545.250366 |
| PSA | 127.82000 |
| LogP | 2.37760 |
| Vapour Pressure | 3.24E-22mmHg at 25°C |
| InChIKey | DLPGJHSONYLBKP-IKGOIYPNSA-N |
| SMILES | CC1(C)OCC(COC(=O)CCc2ccc(OCC(O)CNCCNC(=O)N3CCOCC3)cc2)O1.Cl |
| RTECS | DA8346700 |
|---|
|
~48%
Landiolol Hydro... CAS#:144481-98-1 |
| Literature: Procos S.p.A.; Garavaglia, Fabio; Roletto, Jacopo; Paissoni, Paolo Patent: EP2687521 A1, 2014 ; Location in patent: Paragraph 0053; 0054; 0055; 0056; 0057 ; |
|
~77%
Landiolol Hydro... CAS#:144481-98-1 |
| Literature: Procos S.p.A.; Garavaglia, Fabio; Roletto, Jacopo; Paissoni, Paolo Patent: EP2687521 A1, 2014 ; Location in patent: Paragraph 0051; 0052 ; |
|
~%
Landiolol Hydro... CAS#:144481-98-1 |
| Literature: EP2687521 A1, ; |
| ((S)-2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(4-((S)-2-hydroxy-3-(2-(morpholine-4-carboxamido)ethylamino)propoxy)phenyl)propanoate hydrochloride |
| [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 3-[4-[(2S)-2-hydroxy-3-[2-(morpholine-4-carbonylamino)ethylamino]propoxy]phenyl]propanoate hydrochloride |
| (-)-[(S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-3-[4-[(S)-2-hydroxy-3-(2-morpholinocarbonylamino)ethylamino]propoxy]phenylpropionic acid hydrochloride |
| (-)-[(S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 3-[4-[(S)-2-hydroxy-3-(2-(morpholinocarbonylamino)ethylamino)propoxy]phenyl]propionate monohydrochloride |
| Benzenepropanoic acid,4-(2-hydroxy-3-((2-((4-morpholinylcarbonyl)amino)ethyl)amino)propoxy)-,(2,2-dimethyl-1,3-dioxolan-4-yl)methyl ester,(S-(R*,R*))-,hydrochloride |
| Landiololhydrochloride |
| Benzenepropanoic acid, 4-[(2S)-2-hydroxy-3-[[2-[(4-morpholinylcarbonyl)amino]ethyl]amino]propoxy]-, [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester, hydrochloride (1:1) |
| Ono 1101 hydrochloride |
| 2,2-dimethyl-1,3-dioxolan-4S-yl-methyl 3-[P-{3-{(2-(morpholinocarbonylamino)ethyl)amino}-2S-hydroxypropoxy}phenyl] propionate hydrochloride |
| [(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]methyl 3-{4-[(2S)-2-hydroxy-3-({2-[(4-morpholinylcarbonyl)amino]ethyl}amino)propoxy]phenyl}propanoate hydrochloride (1:1) |