1-(Octanoyloxy)-2,5-pyrrolidinedione structure
|
Common Name | 1-(Octanoyloxy)-2,5-pyrrolidinedione | ||
|---|---|---|---|---|
| CAS Number | 14464-30-3 | Molecular Weight | 241.284 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 333.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | 61-63ºC | |
| MSDS | N/A | Flash Point | 155.3±23.2 °C | |
| Name | 1-(Octanoyloxy)-2,5-pyrrolidinedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.2±25.0 °C at 760 mmHg |
| Melting Point | 61-63ºC |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 155.3±23.2 °C |
| Exact Mass | 241.131409 |
| PSA | 63.68000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | PEJVSXYBFAVPAQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |
| Safety Phrases | 22-24/25 |
|---|---|
| HS Code | 2925190090 |
|
~78%
1-(Octanoyloxy)... CAS#:14464-30-3 |
| Literature: Vavrova, Katerina; Hrabalek, Alexandr; Dolezal, Pavel; Samalova, Lucie; Palat, Karel; Zbytovska, Jarmila; Holas, Tomas; Klimentova, Jana Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 24 p. 5381 - 5390 |
|
~83%
1-(Octanoyloxy)... CAS#:14464-30-3 |
| Literature: Genzyme Corporation Patent: US2003/50299 A1, 2003 ; |
|
~93%
1-(Octanoyloxy)... CAS#:14464-30-3 |
| Literature: Schulze, Agnes; Giannis, Athanassios Advanced Synthesis and Catalysis, 2004 , vol. 346, # 2-3 p. 252 - 256 |
|
~9%
1-(Octanoyloxy)... CAS#:14464-30-3 |
| Literature: Schulze, Agnes; Giannis, Athanassios Advanced Synthesis and Catalysis, 2004 , vol. 346, # 2-3 p. 252 - 256 |
|
~%
1-(Octanoyloxy)... CAS#:14464-30-3 |
| Literature: Kim, Sunggak; Lee, Jae In; Ko, Young Kwan Tetrahedron Letters, 1984 , vol. 25, # 43 p. 4943 - 4946 |
|
~91%
1-(Octanoyloxy)... CAS#:14464-30-3 |
| Literature: Schulze, Agnes; Giannis, Athanassios Advanced Synthesis and Catalysis, 2004 , vol. 346, # 2-3 p. 252 - 256 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| octanoic acid succinimidyl ester |
| N-(octanoyloxy)succinimide |
| Octansaeure-sec-butylester |
| Octanoic acid,2-butyl ester |
| 2,5-dioxopyrrolidin-1-yl octanoate |
| sec-butyl caprylate |
| octanoic acid N-hydroxysuccinimide ester |
| Octanoic acid,1-methylpropyl ester |
| 2,5-Pyrrolidinedione, 1-[(1-oxooctyl)oxy]- |
| octanoic acid N-succinimidyl ester |
| octanoic acid sec-butyl ester |
| Caprylsaeure-2-butanester |
| 1-(Octanoyloxy)-2,5-pyrrolidinedione |
| Sec-butyl octanoate |