2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene
2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene structure
|
Common Name | 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 144653-01-0 | Molecular Weight | 368.10600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16Br2 |
|---|---|
| Molecular Weight | 368.10600 |
| Exact Mass | 365.96200 |
| LogP | 6.11220 |
| InChIKey | PDTMQXWKUBOMQJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cc(C)c(Br)c(C)c2)cc(C)c1Br |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
2-bromo-5-(4-br... CAS#:144653-01-0 |
| Literature: Sasaki, Shigeru; Murakami, Fumiki; Murakami, Midori; Watanabe, Mariko; Kato, Kiyotoshi; Sutoh, Katsuhide; Yoshifuji, Masaaki Journal of Organometallic Chemistry, 2005 , vol. 690, # 10 p. 2664 - 2672 |
|
~42%
2-bromo-5-(4-br... CAS#:144653-01-0 |
| Literature: ENIRICERCHE S.p.A. Patent: EP492694 A1, 1992 ; |
|
~43%
2-bromo-5-(4-br... CAS#:144653-01-0 |
| Literature: Alberti, Giulio; Costantino, Umberto; Marmottini, Fabio; Vivani, Riccardo; Zappelli, Piergiorgio Angewandte Chemie, 1993 , vol. 105, # 9 p. 1396 - 1398 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-dibromo-3,3',5,5'-tetramethylbiphenyl |
| 4,4'-Dibrom-3,3',5,5'-tetramethylbiphenyl |
| 1,1'-Biphenyl,4,4'-dibromo-3,3',5,5'-tetramethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: InChIKey of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is PDTMQXWKUBOMQJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: SMILES notation of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is Cc1cc(-c2cc(C)c(Br)c(C)c2)cc(C)c1Br. |
| Q: What is the CAS number of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: CAS number of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is 144653-01-0. |
| Q: What are the upstream materials of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: Related upstream materials(CAS) of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene: 689260-53-5;540-80-7;54827-17-7;25570-02-9. |
| Q: What is the LogP of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: LogP of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is 6.11220. |
| Q: What is the molecular weight of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: Molecular weight of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is 368.10600. |
| Q: What is the molecular formula of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: Molecular formula of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is C16H16Br2. |
| Q: What is the Chinese name of 144653-01-0? |
| A: Chinese name of 144653-01-0 is 144653-01-0. |
| Q: What is the English name of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene? |
| A: The English name of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene is 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene. |
| Q: What English synonyms does 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene have? |
| A: English synonyms of 2-bromo-5-(4-bromo-3,5-dimethylphenyl)-1,3-dimethylbenzene: 4,4'-dibromo-3,3',5,5'-tetramethylbiphenyl, 4,4'-Dibrom-3,3',5,5'-tetramethylbiphenyl, 1,1'-Biphenyl,4,4'-dibromo-3,3',5,5'-tetramethyl. |