4F 4PP oxalate structure
|
Common Name | 4F 4PP oxalate | ||
|---|---|---|---|---|
| CAS Number | 144734-36-1 | Molecular Weight | 429.48100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4F 4PP oxalate4F 4PP (oxalate) is a selective 5-HT2A antagonist with almost as high affinity (Ki= 5.3 nM) as ketanserin but with a much lower affinity for 5-HT2C sites (Ki= 620 nM)[1][2][3][4]. |
| Name | (4-Fluorophenyl)[1-(4-phenylbutyl)-4-piperidinyl]methanone ethane dioate (1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | 4F 4PP (oxalate) is a selective 5-HT2A antagonist with almost as high affinity (Ki= 5.3 nM) as ketanserin but with a much lower affinity for 5-HT2C sites (Ki= 620 nM)[1][2][3][4]. |
|---|---|
| Related Catalog | |
| Target |
5-HT2A Receptor:5.3 nM (Ki) 5-HT2C Receptor:620 nM (Ki) |
| In Vivo | 4F 4PP (100 nM) reduces the lowest [D-ala2,N-me-phe4,gly.l5]-enkephalin (DAMGO) concentration and can produce a significant depression of evoked field potentials[1]. |
| References |
| Molecular Formula | C24H28FNO5 |
|---|---|
| Molecular Weight | 429.48100 |
| Exact Mass | 429.19500 |
| PSA | 94.91000 |
| LogP | 3.83680 |
| InChIKey | VUJYJCRJPFMHEM-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)O.O=C(c1ccc(F)cc1)C1CCN(CCCCc2ccccc2)CC1 |
| D-myo-Inositol-1,3,4,5-tetrakisphosphate,octapotassium salt |