1-[5-O-[Bis(4-methoxyphenyl)phenylmethyl]-2-deoxy-2-fluoro-β-D-arabinofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione structure
|
Common Name | 1-[5-O-[Bis(4-methoxyphenyl)phenylmethyl]-2-deoxy-2-fluoro-β-D-arabinofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione | ||
|---|---|---|---|---|
| CAS Number | 144822-48-0 | Molecular Weight | 562.58500 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H31FN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[5-O-[Bis(4-methoxyphenyl)phenylmethyl]-2-deoxy-2-fluoro-β-D-arabinofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C31H31FN2O7 |
| Molecular Weight | 562.58500 |
| Exact Mass | 562.21200 |
| PSA | 112.01000 |
| LogP | 3.46730 |
| Index of Refraction | 1.639 |
| InChIKey | RWIIURMGSYIIES-LLNGEMMXSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)C(F)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
|
~%
1-[5-O-[Bis(4-m... CAS#:144822-48-0 |
| Literature: Wang, Qiang; Li, Yanfeng; Song, Chuanjun; Qian, Keduo; Chen, Chin-Ho; Lee, Kuo-Hsiung; Chang, Junbiao Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 14 p. 4053 - 4056 |
| 1-{5-O-[Bis-(4-methoxyphenyl)-phenylmethyl]-2-deoxy-2-fluoro--D-arabinofuranosyl}-5-methyl-2,4(1H,3H)-pyrimidinedione |