Desoxycarbadox-D3 structure
|
Common Name | Desoxycarbadox-D3 | ||
|---|---|---|---|---|
| CAS Number | 1448350-02-4 | Molecular Weight | 233.241 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7D3N4O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS02, GHS07, GHS08 |
Signal Word | Danger | |
Use of Desoxycarbadox-D3Desoxycarbadox-d3 is the deuterium labeled Desoxycarbadox. Desoxycarbadox is a metabolite of Carbadox (HY-B1340). Carbadox is a quinoxaline-di-N-oxide antibiotic compound. |
| Name | Desoxycarbadox-D3 |
|---|---|
| Synonym | More Synonyms |
| Description | Desoxycarbadox-d3 is the deuterium labeled Desoxycarbadox. Desoxycarbadox is a metabolite of Carbadox (HY-B1340). Carbadox is a quinoxaline-di-N-oxide antibiotic compound. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H7D3N4O2 |
| Molecular Weight | 233.241 |
| Exact Mass | 233.099213 |
| LogP | 1.72 |
| Index of Refraction | 1.634 |
| InChIKey | SOEMFPLGOUBPJQ-QQAPZFQVSA-N |
| SMILES | COC(=O)NN=Cc1cnc2ccccc2n1 |
| Symbol |
GHS02, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228-H302-H350 |
| Precautionary Statements | P201-P210-P308 + P313 |
| Hazard Codes | F,T |
| Risk Phrases | R45-11-22 |
| Safety Phrases | S53-45 |
| RIDADR | UN1325 - class 4.1 - PG 2 - Flammable solids, organic, n.o.s., HI: all |
| Hydrazinecarboxylic acid, 2-(2-quinoxalinylmethylene)-, methyl-d3 ester, (2E)- |
| (2H3)Methyl (2E)-2-(2-quinoxalinylmethylene)hydrazinecarboxylate |