NYC-488 structure
|
Common Name | NYC-488 | ||
|---|---|---|---|---|
| CAS Number | 1448429-06-8 | Molecular Weight | 460.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17FN6O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NYC-488Calpain Inhibitor-1 (compound 36) is a potent and selective cysteine protease calpain 1 (Cal1) inhibitor (IC50=100 nM; Ki=2.89 μM)[1]. |
| Name | Calpain Inhibitor-1 |
|---|
| Description | Calpain Inhibitor-1 (compound 36) is a potent and selective cysteine protease calpain 1 (Cal1) inhibitor (IC50=100 nM; Ki=2.89 μM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H17FN6O5S |
|---|---|
| Molecular Weight | 460.44 |
| InChIKey | IPWMYOJQVHCYRC-JYJNAYRXSA-N |
| SMILES | O=C(NCc1cn(-c2ccc(F)cc2)nn1)C(Cc1cscn1)NC(=O)C1OC1C(=O)O |