ZYZ-488 structure
|
Common Name | ZYZ-488 | ||
|---|---|---|---|---|
| CAS Number | 1470302-79-4 | Molecular Weight | 487.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29N3O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ZYZ-488ZYZ-488 is a competitive apoptotic protease activating factor-1 (Apaf-1) inhibitor, which inhibits the activation of binding protein procaspase-9 and procaspase-3[1]. |
| Name | ZYZ-488 |
|---|
| Description | ZYZ-488 is a competitive apoptotic protease activating factor-1 (Apaf-1) inhibitor, which inhibits the activation of binding protein procaspase-9 and procaspase-3[1]. |
|---|---|
| Related Catalog | |
| Target |
Apoptotic protease activating factor-1[1] |
| References |
| Molecular Formula | C20H29N3O11 |
|---|---|
| Molecular Weight | 487.46 |
| InChIKey | PVTAIJDQJJZCJP-WXZWTWHISA-N |
| SMILES | COc1cc(C(=O)OCCCCN=C(N)N)cc(OC)c1OC1OC(C(=O)O)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|