2-Fluoro-6-(trifluoromethyl)benzamide structure
|
Common Name | 2-Fluoro-6-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 144851-59-2 | Molecular Weight | 207.12500 | |
| Density | 1.42g/cm3 | Boiling Point | 203ºC at 760mmHg | |
| Molecular Formula | C8H5F4NO | Melting Point | 144-147 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 76.6ºC | |
| Name | 2-Fluoro-6-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 203ºC at 760mmHg |
| Melting Point | 144-147 °C(lit.) |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.12500 |
| Flash Point | 76.6ºC |
| Exact Mass | 207.03100 |
| PSA | 43.09000 |
| LogP | 2.64370 |
| Vapour Pressure | 0.283mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | BYQGJCJJFXIYHC-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(F)cccc1C(F)(F)F |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00083555 |
| 2-fluoro-6-(trifluoromethyl)benzamide |