H-Met-Met-Met-OH structure
|
Common Name | H-Met-Met-Met-OH | ||
|---|---|---|---|---|
| CAS Number | 14486-15-8 | Molecular Weight | 411.60300 | |
| Density | 1.249g/cm3 | Boiling Point | 747.9ºC at 760 mmHg | |
| Molecular Formula | C15H29N3O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 406.1ºC | |
| Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 747.9ºC at 760 mmHg |
| Molecular Formula | C15H29N3O4S3 |
| Molecular Weight | 411.60300 |
| Flash Point | 406.1ºC |
| Exact Mass | 411.13200 |
| PSA | 197.42000 |
| LogP | 2.10930 |
| Vapour Pressure | 1.78E-24mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | VWWGEKCAPBMIFE-SRVKXCTJSA-N |
| SMILES | CSCCC(N)C(=O)NC(CCSC)C(=O)NC(CCSC)C(=O)O |
| HS Code | 2930909090 |
|---|
|
~%
H-Met-Met-Met-OH CAS#:14486-15-8
Detail
|
| Literature: Kino, Kuniki; Arai, Toshinobu; Tateiwa, Daisuke Bioscience, Biotechnology and Biochemistry, 2010 , vol. 74, # 1 p. 129 - 134 |
|
~%
H-Met-Met-Met-OH CAS#:14486-15-8 |
| Literature: Brenner; Pfister Helvetica Chimica Acta, 1951 , vol. 34, p. 2085,2093 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Met-L-Met-L-Met |
| L-Methionyl=>L-methionyl=>L-methionin |
| L-methionyl=>L-methionyl=>L-methionine |
| Methionyl-methionyl-methionyl |
| Trimethionine |
| H2N-Met-Met-Met-OH |
| Met-met-met |
| H-Met-Met-Met-OH |