Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate structure
|
Common Name | Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1459-96-7 | Molecular Weight | 226.269 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 273.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.0±20.2 °C | |
| Name | dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.6±20.0 °C at 760 mmHg |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.269 |
| Flash Point | 127.0±20.2 °C |
| Exact Mass | 226.120514 |
| PSA | 52.60000 |
| LogP | 1.99 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | HDOVTVDGSLEUSK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(C(=O)OC)(CC1)CC2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917209090 |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate |
| Bicyclo[2.2.2]octane-1,4-dicarboxylic acid, dimethyl ester |
| dimethyl bicyclo<2.2.2>octane-1,4-dicarboxylate |
| Bicyclo<2.2.2>octan-1,4-dicarbonsaeure-dimethylester |