Silane,(phenylmethylene)bis[trimethyl structure
|
Common Name | Silane,(phenylmethylene)bis[trimethyl | ||
|---|---|---|---|---|
| CAS Number | 14595-77-8 | Molecular Weight | 236.50100 | |
| Density | 0.853g/cm3 | Boiling Point | 247ºC at 760mmHg | |
| Molecular Formula | C13H24Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.3ºC | |
| Name | trimethyl-[phenyl(trimethylsilyl)methyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.853g/cm3 |
|---|---|
| Boiling Point | 247ºC at 760mmHg |
| Molecular Formula | C13H24Si2 |
| Molecular Weight | 236.50100 |
| Flash Point | 85.3ºC |
| Exact Mass | 236.14200 |
| LogP | 4.62050 |
| Vapour Pressure | 0.0412mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | NISUIYZIODIZTR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(c1ccccc1)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| benzal trimethylsilane |