GDP structure
|
Common Name | GDP | ||
|---|---|---|---|---|
| CAS Number | 146-91-8 | Molecular Weight | 443.20100 | |
| Density | 2.63 g/cm3 | Boiling Point | 961ºC at 760 mmHg | |
| Molecular Formula | C10H15N5O11P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 535ºC | |
Use of GDPGuanosine 5'-diphosphate is a nucleoside diphosphate. Guanosine 5'-diphosphate consists of a pyrophosphate group, a pentose sugar ribose, and the nucleobaseguanine. Guanosine 5'-diphosphate is the product of GTP dephosphorylation by GTPases. |
| Name | GDP |
|---|---|
| Synonym | More Synonyms |
| Description | Guanosine 5'-diphosphate is a nucleoside diphosphate. Guanosine 5'-diphosphate consists of a pyrophosphate group, a pentose sugar ribose, and the nucleobaseguanine. Guanosine 5'-diphosphate is the product of GTP dephosphorylation by GTPases. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 2.63 g/cm3 |
|---|---|
| Boiling Point | 961ºC at 760 mmHg |
| Molecular Formula | C10H15N5O11P2 |
| Molecular Weight | 443.20100 |
| Flash Point | 535ºC |
| Exact Mass | 443.02400 |
| PSA | 272.19000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.94 |
| InChIKey | QGWNDRXFNXRZMB-UUOKFMHZSA-N |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)(O)OP(=O)(O)O)C(O)C2O)c(=O)[nH]1 |
| Storage condition | −20°C |
| Water Solubility | H2O: 50 mg/mL, clear, colorless |
| Safety Phrases | S22-S24/25 |
|---|---|
| WGK Germany | 3 |
| Guanosine 5-Diphosphate |
| MFCD06656011 |
| [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| EINECS 231-026-2 |
| Guanosine 5'-(trihydrogen diphosphate) |