TIPP structure
|
Common Name | TIPP | ||
|---|---|---|---|---|
| CAS Number | 146369-65-5 | Molecular Weight | 634.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H38N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TIPPTIPP is a potent and selective δ-opioid antagonist with a Ki value of 1.22 nM[1]. |
| Name | (2S)-2-[[(2S)-2-[[(3S)-2-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | TIPP is a potent and selective δ-opioid antagonist with a Ki value of 1.22 nM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C37H38N4O6 |
|---|---|
| Molecular Weight | 634.72 |
| Exact Mass | 634.27900 |
| PSA | 162.06000 |
| LogP | 4.17510 |
| InChIKey | JYOUATXRHWNDDW-YRCZKMHPSA-N |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)N1Cc2ccccc2CC1C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| Tyr-tic-phe-phe-OH |
| H-Tyr-Tic-Phe-Phe-OH |
| L-Phenylalanine,L-tyrosyl-L-1,2,3,4-tetrahydro-3-isoquinolinecarbonyl-L-phenylalanyl |
| TIPP |