1,1,1-tris(2-cyanoethyl)nitromethane structure
|
Common Name | 1,1,1-tris(2-cyanoethyl)nitromethane | ||
|---|---|---|---|---|
| CAS Number | 1466-48-4 | Molecular Weight | 220.22800 | |
| Density | 1.18g/cm3 | Boiling Point | 514.6ºC at 760mmHg | |
| Molecular Formula | C10H12N4O2 | Melting Point | 111-113ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 265ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1,1-tris(2-cyanoethyl)nitromethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 514.6ºC at 760mmHg |
| Melting Point | 111-113ºC(lit.) |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.22800 |
| Flash Point | 265ºC |
| Exact Mass | 220.09600 |
| PSA | 117.19000 |
| LogP | 2.43644 |
| Vapour Pressure | 1.07E-10mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | MUPJJZVGSOUSFH-UHFFFAOYSA-N |
| SMILES | N#CCCC(CCC#N)(CCC#N)[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
|
~84%
1,1,1-tris(2-cy... CAS#:1466-48-4 |
| Literature: Newkome, George R.; Moorefield, Charles N.; Theriot, Kevin J. Journal of Organic Chemistry, 1988 , vol. 53, # 23 p. 5552 - 5554 |
|
~%
1,1,1-tris(2-cy... CAS#:1466-48-4 |
| Literature: I.G.Farbenind. Patent: DE728531 , 1940 ; DRP/DRBP Org.Chem. |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis of 1-azoniatricyclo-(3, 3, 3, 0)-undecane bromide. Šorm F and Beránek J.
Collect. Czech. Chem. Commun. 19(2) , 298-304, (1954)
|
|
|
The crystal structure of 2-amino-5, 5'-bis (ß-cyanoethyl)-1, 2-pyrrolenineN-oxide monohydrate. Newkome GR, et al.
J. Chem. Crystallogr. 25(9) , 569-71, (1995)
|
| MFCD00013830 |
| nitromethanetrispropionitrile |
| 4-cyanoethyl-4-nitropimelonitrile |
| EINECS 215-983-3 |