4-(2-carboxyethyl)-4-nitroheptanedioic acid structure
|
Common Name | 4-(2-carboxyethyl)-4-nitroheptanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 59085-15-3 | Molecular Weight | 277.22800 | |
| Density | 1.456 g/cm3 | Boiling Point | 570.4ºC at 760 mmHg | |
| Molecular Formula | C10H15NO8 | Melting Point | 181-184ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(2-carboxyethyl)-4-nitroheptanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456 g/cm3 |
|---|---|
| Boiling Point | 570.4ºC at 760 mmHg |
| Melting Point | 181-184ºC |
| Molecular Formula | C10H15NO8 |
| Molecular Weight | 277.22800 |
| Exact Mass | 277.08000 |
| PSA | 157.72000 |
| LogP | 1.11950 |
| Index of Refraction | 1.532 |
| InChIKey | JCMYUFMDOYGRKD-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(CCC(=O)O)(CCC(=O)O)[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2917190090 |
|
~96%
4-(2-carboxyeth... CAS#:59085-15-3 |
| Literature: Ornelas, Catia; Pennell, Ryan; Liebes, Leonard F.; Weck, Marcus Organic Letters, 2011 , vol. 13, # 5 p. 976 - 979 |
|
~97%
4-(2-carboxyeth... CAS#:59085-15-3 |
| Literature: Weis, Claus D.; Newkome, George R. Journal of Organic Chemistry, 1990 , vol. 55, # 22 p. 5801 - 5802 |
|
~96%
4-(2-carboxyeth... CAS#:59085-15-3 |
| Literature: Newkome, George R.; Moorefield, Charles N.; Theriot, Kevin J. Journal of Organic Chemistry, 1988 , vol. 53, # 23 p. 5552 - 5554 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Tris(2-carboxyethyl)nitromethane |
| MFCD00077684 |
| 4-(2-Carboxyethyl)-4-nitro heptanedioic acid |
| 4-(2-Carboxy-aethyl)-4-nitro-heptandisaeure |
| 3 dade:nitro[1]:(3-oxo-2-azapropylidine):propanoic |
| Nitromethanetrispropionic acid |
| nitromethanetripropionic acid |
| 4-(2-Carboxyethyl)-4-nitropimelic acid |