5-(1H-Benzo[d]imidazol-2-yl)pentanoic acid structure
|
Common Name | 5-(1H-Benzo[d]imidazol-2-yl)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 14678-78-5 | Molecular Weight | 218.25200 | |
| Density | 1.268g/cm3 | Boiling Point | 504.1ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.7ºC | |
| Name | 5-(1H-benzimidazol-2-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 504.1ºC at 760 mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25200 |
| Flash Point | 258.7ºC |
| Exact Mass | 218.10600 |
| PSA | 65.98000 |
| LogP | 2.36030 |
| Vapour Pressure | 5.54E-11mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | NVXHPONACTZBEP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCc1nc2ccccc2[nH]1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933290090 |
|
~80%
5-(1H-Benzo[d]i... CAS#:14678-78-5 |
| Literature: Tewari, Ashish Kumar; Mishra, Anil Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2006 , vol. 45, # 2 p. 489 - 493 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-benzimidazol-2-ylpentanoic acid |
| 5-(1H-benzoimidazol-2-yl)-pentanoic acid |
| 5-(1H-1,3-benzodiazol-2-yl)pentanoic acid |
| 5-(1H-Benzimidazol-2-yl)-valeriansaeure |
| 5-(1H-benzimidazol-2-yl)-valeric acid |
| 5-(2-Benzimidazolyl)-valeriansaeure |