nafcillin structure
|
Common Name | nafcillin | ||
|---|---|---|---|---|
| CAS Number | 147-52-4 | Molecular Weight | 414.475 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 714.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 385.7±32.9 °C | |
Use of nafcillinNafcillin, an antibiotic, is a reversible inhibitor of β-lactamase. Nafcillin exhibits bactericidal activity, and can be used for the research of staphylococcal infections[1][2][3][4]. |
| Name | nafcillin |
|---|---|
| Synonym | More Synonyms |
| Description | Nafcillin, an antibiotic, is a reversible inhibitor of β-lactamase. Nafcillin exhibits bactericidal activity, and can be used for the research of staphylococcal infections[1][2][3][4]. |
|---|---|
| Related Catalog | |
| In Vivo | Nafcillin (100 mg/kg; s.c.) exhibits bactericidal activity against methicillin-susceptible Staphylococcus aureus (MSSA) and methicillin-resistant S. aureus (MRSA), with MICs of 0.5 μg/mL and 64.0 μg/mL for S. aureus strains Xen-29 and Xen-1, respectively, in mice[3]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 714.1±60.0 °C at 760 mmHg |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.475 |
| Flash Point | 385.7±32.9 °C |
| Exact Mass | 414.124939 |
| PSA | 121.24000 |
| LogP | 3.52 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | GPXLMGHLHQJAGZ-JTDSTZFVSA-N |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Propizepina |
| 6-(2-dimethylamino-propyl)-6,11-dihydro-benzo[b]pyrido[2,3-e][1,4]diazepin-5-one |
| 6-(2-Ethoxy-naphth-1-yl-formamino)penicillansaeure |
| nafcillinum [INN_la] |
| (2S,5R,6R)-6-({[2-(ethyloxy)naphthalen-1-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| (2S,5R,6R)-6-{[(2-ethoxynaphthalen-1-yl)carbonyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Propizepinum |
| (2-ethoxy-naphthalen-1-yl)-penicillin |
| [2S-(2a,5a,6b)]-6-[[(2-Ethoxy-1-naphthalenyl)carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic Acid |
| Naftopen |
| Nallpen |
| Propizepinum [INN-Latin] |
| 6-(2-Ethoxy-1-naphthamido)penicillin |
| Propizepina [INN-Spanish] |
| Vagran 50 Kapseln |
| Propizepine |
| (2S,5R,6R)-6-[(2-Ethoxy-1-naphthoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |