Methanone,(2-hydroxy-5-methylphenyl)phenyl- structure
|
Common Name | Methanone,(2-hydroxy-5-methylphenyl)phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1470-57-1 | Molecular Weight | 212.24400 | |
| Density | 1.164g/cm3 | Boiling Point | 340.2ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | 83-85 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 144.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Hydroxy-5-methylbenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 340.2ºC at 760 mmHg |
| Melting Point | 83-85 °C(lit.) |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 144.8ºC |
| Exact Mass | 212.08400 |
| PSA | 37.30000 |
| LogP | 2.93160 |
| Vapour Pressure | 4.44E-05mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | OQERFUGURPLBQH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C(=O)c2ccccc2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| MFCD00002379 |
| 2-hydroxy-5-methylbenzophenone |
| EINECS 216-002-1 |