frovatriptan structure
|
Common Name | frovatriptan | ||
|---|---|---|---|---|
| CAS Number | 147009-08-3 | Molecular Weight | 243.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | frovatriptan |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17N3O |
|---|---|
| Molecular Weight | 243.30400 |
| Exact Mass | 243.13700 |
| PSA | 70.91000 |
| LogP | 2.43470 |
| InChIKey | XPSQPHWEGNHMSK-UHFFFAOYSA-N |
| SMILES | CNC1CCc2[nH]c3ccc(C(N)=O)cc3c2C1 |
|
~%
frovatriptan CAS#:147009-08-3 |
| Literature: ORCHID CHEMICALS AND PHARAMCEUTICALS LIMITED; REGURI, Buchi Reddy; UPPARAPALLI, Sampathkumar; KUNCHITHAPATHAM, Thirumurugan; SAMBASHIVAM, Thiyagarajan; MUNUSAMY, Suresh Patent: WO2012/147020 A1, 2012 ; |
|
~%
frovatriptan CAS#:147009-08-3 |
| Literature: ORCHID CHEMICALS AND PHARAMCEUTICALS LIMITED; REGURI, Buchi Reddy; UPPARAPALLI, Sampathkumar; KUNCHITHAPATHAM, Thirumurugan; SAMBASHIVAM, Thiyagarajan; MUNUSAMY, Suresh Patent: WO2012/147020 A1, 2012 ; |
|
~%
frovatriptan CAS#:147009-08-3 |
| Literature: ORCHID CHEMICALS AND PHARAMCEUTICALS LIMITED; REGURI, Buchi Reddy; UPPARAPALLI, Sampathkumar; KUNCHITHAPATHAM, Thirumurugan; SAMBASHIVAM, Thiyagarajan; MUNUSAMY, Suresh Patent: WO2012/147020 A1, 2012 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (+-)-6'-bromo-3',4'-dihydro-1'H-spiro[imidazolidine-4,2'-naphthalene]-2,5-dione |
| 3',4'-dihydro-6'-bromo-spiro[imidazolidine-4,2'(1'H)-naphthalene]-2,5-dione |
| (+/-)-6-carbamoyl-3-methylamino-1,2,3,4-tetrahydrocarbazole |
| rac-frovatriptan |
| 3',4'-Dihydro-6'-bromo-spiro[imidazolidine-4,2(1'H)-naphtalene]-2,5-dione |
| (+/-)-6-carboxamide-3-methylamino-1,2,3,4-tetrahydrocarbazole |