3,5-BIS(TRIFLUOROMETHYL)PYRAZOLE structure
|
Common Name | 3,5-BIS(TRIFLUOROMETHYL)PYRAZOLE | ||
|---|---|---|---|---|
| CAS Number | 14704-41-7 | Molecular Weight | 204.07300 | |
| Density | 1.594g/cm3 | Boiling Point | 151.5ºC at 760mmHg | |
| Molecular Formula | C5H2F6N2 | Melting Point | 83-85 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 45.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,5-Bis(trifluoromethyl)pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.594g/cm3 |
|---|---|
| Boiling Point | 151.5ºC at 760mmHg |
| Melting Point | 83-85 °C(lit.) |
| Molecular Formula | C5H2F6N2 |
| Molecular Weight | 204.07300 |
| Flash Point | 45.4ºC |
| Exact Mass | 204.01200 |
| PSA | 28.68000 |
| LogP | 2.44730 |
| InChIKey | NGDDUAYSWPUSLX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)[nH]n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933199090 |
|
~87%
3,5-BIS(TRIFLUO... CAS#:14704-41-7 |
| Literature: Maspero, Angelo; Giovenzana, Giovanni B.; Monticelli, Damiano; Tagliapietra, Silvia; Palmisano, Giovanni; Penoni, Andrea Journal of Fluorine Chemistry, 2012 , vol. 139, p. 53 - 57 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Calcium-induced calcium release and gap junctions mediate large-scale calcium waves in olfactory ensheathing cells in situ.
Cell Calcium 58 , 215-25, (2015) Olfactory ensheathing cells (OECs) are a specialised type of glial cells, supporting axon growth and guidance during development and regeneration of the olfactory nerve and the nerve layer of the olfa... |
| 3,5-bis(trifluoromethyl)-1H-pyrazole |
| MFCD00153672 |