Benzenamine,2-nitro-N-(phenylmethylene)- structure
|
Common Name | Benzenamine,2-nitro-N-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 14717-15-8 | Molecular Weight | 226.23100 | |
| Density | 1.16g/cm3 | Boiling Point | 412.6ºC at 760mmHg | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | N-(2-nitrophenyl)-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 412.6ºC at 760mmHg |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23100 |
| Flash Point | 203.3ºC |
| Exact Mass | 226.07400 |
| PSA | 58.18000 |
| LogP | 3.86860 |
| Vapour Pressure | 1.23E-06mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | CUGLXSQFXIEALI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1N=Cc1ccccc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-Benzyliden-2-nitro-anilin |
| Benzaldehyd-<2-nitro-anil> |
| N-benzylidene-2-nitroaniline |