GSK2981278 structure
|
Common Name | GSK2981278 | ||
|---|---|---|---|---|
| CAS Number | 1474110-21-8 | Molecular Weight | 461.614 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 622.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C25H35NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.3±34.3 °C | |
Use of GSK2981278GSK2981278 is a retinoid-related orphan receptor gamma (RORy) modulator, extracted from patent WO/2015061515 A1, example 124. |
| Name | N-(4-Ethylphenyl)-3-(hydroxymethyl)-N-isobutyl-4-(tetrahydro-2H-pyran-4-ylmethoxy)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | GSK2981278 is a retinoid-related orphan receptor gamma (RORy) modulator, extracted from patent WO/2015061515 A1, example 124. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 622.6±65.0 °C at 760 mmHg |
| Molecular Formula | C25H35NO5S |
| Molecular Weight | 461.614 |
| Flash Point | 330.3±34.3 °C |
| Exact Mass | 461.223602 |
| LogP | 4.00 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | LZLBRISQTJVZNP-UHFFFAOYSA-N |
| SMILES | CCc1ccc(N(CC(C)C)S(=O)(=O)c2ccc(OCC3CCOCC3)c(CO)c2)cc1 |
| N-(4-Ethyl-phenyl)-3-hydroxymethyl-N-isobutyl-4-(tetrahydro-pyran-4-ylmethoxy)-benzenesulfonamide |
| Benzenesulfonamide, N-(4-ethylphenyl)-3-(hydroxymethyl)-N-(2-methylpropyl)-4-[(tetrahydro-2H-pyran-4-yl)methoxy]- |
| N-(4-Ethylphenyl)-3-(hydroxymethyl)-N-isobutyl-4-(tetrahydro-2H-pyran-4-ylmethoxy)benzenesulfonamide |
| GSK2981278 |