N-3-oxo-decanoyl-L-Homoserine lactone structure
|
Common Name | N-3-oxo-decanoyl-L-Homoserine lactone | ||
|---|---|---|---|---|
| CAS Number | 147795-40-2 | Molecular Weight | 269.34 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 503.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H23NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 258.1±30.1 °C | |
Use of N-3-oxo-decanoyl-L-Homoserine lactoneN-(3-Oxodecanoyl)-L-homoserine lactone (3-Oxo-C10-HSL) is a bacterial quorum sensing signal autoinducer molecule[1]. |
| Name | N-3-oxo-decanoyl-L-Homoserine lactone |
|---|---|
| Synonym | More Synonyms |
| Description | N-(3-Oxodecanoyl)-L-homoserine lactone (3-Oxo-C10-HSL) is a bacterial quorum sensing signal autoinducer molecule[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.2±50.0 °C at 760 mmHg |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 |
| Flash Point | 258.1±30.1 °C |
| Exact Mass | 269.162720 |
| LogP | 0.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | KYGIKEQVUKTKRR-LBPRGKRZSA-N |
| SMILES | CCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| MFCD12912432 |
| N-3-oxo-decanoyl-L-Homoserine lactone |
| 3-oxo-N-[(3S)-2-oxotetrahydrofuran-3-yl]decanamide |
| Decanamide, 3-oxo-N-[(3S)-tetrahydro-2-oxo-3-furanyl]- |
| 3-Oxo-N-[(3S)-2-oxotetrahydro-3-furanyl]decanamide |
| N-(3-Oxodecanoyl)-L-homoserine lactone |