3-hydroxynaphthalene-2,7-disulphonic acid structure
|
Common Name | 3-hydroxynaphthalene-2,7-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 148-75-4 | Molecular Weight | 304.29600 | |
| Density | 1.816g/cm3 | Boiling Point | 415.13°C (rough estimate) | |
| Molecular Formula | C10H8O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.816g/cm3 |
|---|---|
| Boiling Point | 415.13°C (rough estimate) |
| Molecular Formula | C10H8O7S2 |
| Molecular Weight | 304.29600 |
| Exact Mass | 303.97100 |
| PSA | 145.73000 |
| LogP | 3.20040 |
| Index of Refraction | 1.725 |
| InChIKey | USWINTIHFQKJTR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2cc(O)c(S(=O)(=O)O)cc2c1 |
| HS Code | 2908999090 |
|---|
|
~%
3-hydroxynaphth... CAS#:148-75-4 |
| Literature: Chemische Berichte, , vol. 13, p. 1956 DE3229 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 351,377 |
|
~%
3-hydroxynaphth... CAS#:148-75-4 |
| Literature: DE255724 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 217 |
|
~%
3-hydroxynaphth... CAS#:148-75-4 |
| Literature: , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 384 |
|
~%
Detail
|
| Literature: J. Appl. Chem. USSR (Engl. Transl.), , vol. 61, # 7 p. 1540 - 1545,1412 - 1416 |
|
~%
3-hydroxynaphth... CAS#:148-75-4 |
| Literature: DE3229 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 377 Chemische Berichte, , vol. 13, p. 1956 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 205-724-2 |
| 2,7-Naphthalenedisulfonic acid,3-hydroxy |
| 2-hydroxynaphthalene-3,6-disulfonic acid |
| 2-NAPHTHOL-3,6-DISULFONIC ACID |
| 3-hydroxy-naphthalene-2,7-disulfonic acid |
| 2-naphthol-3,6-disulphonic acid |
| 3-Hydroxynaphthalene-2,7-disulphonic acid |
| 2-hydroxy-3,6-naphthalenedisulfonate |
| 2-hydroxy-naphthalene-3,6-disulphonic acid |
| 2-hydroxy-3,6-naphthalenedisulfonic acid |