2-Naphthol-6,8-disulfonic acid structure
|
Common Name | 2-Naphthol-6,8-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 118-32-1 | Molecular Weight | 304.29600 | |
| Density | 1.816g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.816g/cm3 |
|---|---|
| Molecular Formula | C10H8O7S2 |
| Molecular Weight | 304.29600 |
| Exact Mass | 303.97100 |
| PSA | 145.73000 |
| LogP | 3.20040 |
| Index of Refraction | 1.725 |
| InChIKey | DOBIZWYVJFIYOV-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2cc(O)ccc2c1 |
| HS Code | 2908999090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-hydroxynaphthalene-6,8-disulfonic acid |
| 7-Hydroxy-1,3-naphthalenedisulfonic acid |
| 2-hydroxynaphthalene-6,8-disulfonate |
| EINECS 204-245-6 |
| 2-naphthol-6,8-disulphonic acid |
| 2-Naphthol-6,8-disulfonic acid |
| 1,7-hydroxy |
| |A acid |
| 7-hydroxy-1,3-naphthalenedisulfonic acid hydrate |
| G Acid |
| 2-hydroxy-6,8-naphthalenedisulfonic acid |