dihydroxymethoxychlor olefin structure
|
Common Name | dihydroxymethoxychlor olefin | ||
|---|---|---|---|---|
| CAS Number | 14868-03-2 | Molecular Weight | 281.134 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 405.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | 213-217 °C(lit.) | |
| MSDS | N/A | Flash Point | 198.7±27.3 °C | |
| Name | Bisphenol C |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.0±40.0 °C at 760 mmHg |
| Melting Point | 213-217 °C(lit.) |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.134 |
| Flash Point | 198.7±27.3 °C |
| Exact Mass | 280.005798 |
| PSA | 40.46000 |
| LogP | 4.25 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | OWEYKIWAZBBXJK-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C(=C(Cl)Cl)c2ccc(O)cc2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2908199090 |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 4,4'-(2,2-Dichloro-1,1-ethenediyl)diphenol |
| 4,4'-(2,2-Dichloroethene-1,1-diyl)diphenol |
| 4,4'-(2,2-Dichlorovinylidene)bisphenol |
| 4-[2,2-dichloro-1-(4-hydroxyphenyl)ethenyl]phenol |
| MFCD00233304 |
| 1,1-Bis(4-hydroxyphenyl)-2,2-dichloroethylene |
| EINECS 238-940-0 |
| 1,1-Dichloro-2,2-bis(4-hydroxyphenyl)ethylene |
| 4,4'-(Dichloroethenylidene)bis[phenol] |
| dihydroxymethoxychlor olefin |