Ftivazide structure
|
Common Name | Ftivazide | ||
|---|---|---|---|---|
| CAS Number | 149-17-7 | Molecular Weight | 271.27 | |
| Density | 1.3g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O3 | Melting Point | 219-220°C (lit.) | |
| MSDS | N/A | Flash Point | 220.9ºC | |
Use of FtivazideFtivazide has anti-tuberculosis activity[1]. |
| Name | N'-[(E)-(3-methoxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]pyridine-4-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Description | Ftivazide has anti-tuberculosis activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Melting Point | 219-220°C (lit.) |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.27 |
| Flash Point | 220.9ºC |
| Exact Mass | 271.09600 |
| PSA | 83.81000 |
| LogP | 1.95060 |
| Vapour Pressure | 5.36E-08mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | PSWOBQSIXLVPDV-UHFFFAOYSA-N |
| SMILES | COc1cc(C=NNC(=O)c2ccncc2)ccc1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933399090 |
|---|
|
~75%
Ftivazide CAS#:149-17-7 |
| Literature: Shah; Mehta; Parikh Journal of the Indian Chemical Society, 1985 , vol. 62, # 3 p. 255 - 257 |
|
~%
Ftivazide CAS#:149-17-7 |
| Literature: Meyer,H.; Mally Monatshefte fuer Chemie, 1912 , vol. 33, p. 403 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-Hydroxy-5-methoxy-benzaldehyd-isonicotinoylhydrazon |
| Isonicotinic acid vanillylidenehydrazide |
| Phthivazid |
| Phtivazide |
| Isonicotinsaeure-vanillylidenhydrazid |
| Ftivazide |
| Vancide |
| Vanizide |
| 3-Methoxy-4-hydroxy-benzaldehyd-isonicotinoylhydrazon |
| Phthivazidum |
| Vanillaberon |