Dexrazoxane HCl (ICRF-187, ADR-529) structure
|
Common Name | Dexrazoxane HCl (ICRF-187, ADR-529) | ||
|---|---|---|---|---|
| CAS Number | 149003-01-0 | Molecular Weight | 304.73000 | |
| Density | N/A | Boiling Point | 531.5ºC at 760 mmHg | |
| Molecular Formula | C11H17ClN4O4 | Melting Point | 193ºC | |
| MSDS | N/A | Flash Point | 275.3ºC | |
Use of Dexrazoxane HCl (ICRF-187, ADR-529)Dexrazoxane Hcl( ICRF-187 Hcl) is a cardioprotective agent. IC50 value:Target: cardioprotective agentAs a derivative of EDTA, dexrazoxane chelates iron, thus reduce the number of metal ions complexed with anthracycline and, consequently, decrease the formation of superoxide radicals. This agent is used to protect the heart against the cardiotoxic side effects of anthracyclines, such as doxorubicin. It was speculated that dexrazoxane could be used for further investigation to synthesize new antimalarial drugs. |
| Name | dexrazoxane hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Dexrazoxane Hcl( ICRF-187 Hcl) is a cardioprotective agent. IC50 value:Target: cardioprotective agentAs a derivative of EDTA, dexrazoxane chelates iron, thus reduce the number of metal ions complexed with anthracycline and, consequently, decrease the formation of superoxide radicals. This agent is used to protect the heart against the cardiotoxic side effects of anthracyclines, such as doxorubicin. It was speculated that dexrazoxane could be used for further investigation to synthesize new antimalarial drugs. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 531.5ºC at 760 mmHg |
|---|---|
| Melting Point | 193ºC |
| Molecular Formula | C11H17ClN4O4 |
| Molecular Weight | 304.73000 |
| Flash Point | 275.3ºC |
| Exact Mass | 304.09400 |
| PSA | 98.82000 |
| Vapour Pressure | 2.22E-11mmHg at 25°C |
| InChIKey | BIFMNMPSIYHKDN-FJXQXJEOSA-N |
| SMILES | CC(CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1.Cl |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|
| 2,6-Piperazinedione, 4-[(1S)-2-(3,5-dioxo-1-piperazinyl)-1-methylethyl]-, hydrochloride (1:1) |
| 4,4'-(2S)-Propan-1,2-diyldipiperazin-2,6-dionhydrochlorid |
| 4,4'-(2S)-propane-1,2-diyldipipérazine-2,6-dione chlorhydrate |
| (S)-4,4'-(1-Methyl-1,2-ethanediyl)bis-2,6-piperazinedionehydrochloride |
| Dexrazoxane hydrochloride |
| 2,6-Piperazinedione, 4,4'-[(1S)-1-methyl-1,2-ethanediyl]bis-, hydrochloride (1:1) |
| 4,4'-[(2S)-1,2-Propanediyl]di(2,6-piperazinedione) hydrochloride (1:1) |
| 2,6-piperazinedione, 4,4'-[(1S)-1-methyl-1,2-ethanediyl]bis-, monohydrochloride |
| 4,4'-(2S)-Propane-1,2-diyldipiperazine-2,6-dione hydrochloride (1:1) |
| Dexrazoxane HCl |
| UNII:5346058Q7S |
| Dexrazoxane (Hydrochloride) |