6H-Purin-6-one,2-amino-9-cyclohexyl-1,9-dihydro- structure
|
Common Name | 6H-Purin-6-one,2-amino-9-cyclohexyl-1,9-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 14937-71-4 | Molecular Weight | 233.27000 | |
| Density | 1.62g/cm3 | Boiling Point | 530.5ºC at 760mmHg | |
| Molecular Formula | C11H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.6ºC | |
| Name | 2-amino-9-cyclohexyl-1,9-dihydro-purin-6-one |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 530.5ºC at 760mmHg |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27000 |
| Flash Point | 274.6ºC |
| Exact Mass | 233.12800 |
| PSA | 89.59000 |
| LogP | 1.78820 |
| Vapour Pressure | 2.46E-11mmHg at 25°C |
| Index of Refraction | 1.804 |
| InChIKey | QONRRYFWNHZGDD-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2C2CCCCC2)c(=O)[nH]1 |
|
~%
6H-Purin-6-one,... CAS#:14937-71-4 |
| Literature: Michael; Cottam; Smee; Robins; Kini Journal of medicinal chemistry, 1993 , vol. 36, # 22 p. 3431 - 3436 |
|
~%
6H-Purin-6-one,... CAS#:14937-71-4 |
| Literature: Michael; Cottam; Smee; Robins; Kini Journal of medicinal chemistry, 1993 , vol. 36, # 22 p. 3431 - 3436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |