1-(4-BROMOPHENYL)-4-1H-IMIDAZOL-1-YL-BUTANONE structure
|
Common Name | 1-(4-BROMOPHENYL)-4-1H-IMIDAZOL-1-YL-BUTANONE | ||
|---|---|---|---|---|
| CAS Number | 149490-78-8 | Molecular Weight | 293.15900 | |
| Density | 1.39g/cm3 | Boiling Point | 478.6ºC at 760mmHg | |
| Molecular Formula | C13H13BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 1-(4-bromophenyl)-4-imidazol-1-ylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 478.6ºC at 760mmHg |
| Molecular Formula | C13H13BrN2O |
| Molecular Weight | 293.15900 |
| Flash Point | 243.2ºC |
| Exact Mass | 292.02100 |
| PSA | 34.89000 |
| LogP | 3.30870 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | JYNSQBPZCFNNGF-UHFFFAOYSA-N |
| SMILES | O=C(CCCn1ccnc1)c1ccc(Br)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933290090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| OR1653 |
| 1-Butanone,1-(4-bromophenyl)-4-(1H-imidazol-1-yl) |
| 1-(4-bromophenyl)-4-(1H-imidazol-1-yl)-1-butanone |