Propanoic acid,2,2-dimethyl-, 2-naphthalenyl ester
Propanoic acid,2,2-dimethyl-, 2-naphthalenyl ester structure
|
Common Name | Propanoic acid,2,2-dimethyl-, 2-naphthalenyl ester | ||
|---|---|---|---|---|
| CAS Number | 1503-86-2 | Molecular Weight | 228.28600 | |
| Density | 1.083g/cm3 | Boiling Point | 340.1ºC at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | naphthalen-2-yl 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 340.1ºC at 760 mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 117.7ºC |
| Exact Mass | 228.11500 |
| PSA | 26.30000 |
| LogP | 3.79130 |
| Vapour Pressure | 8.77E-05mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | SUGMMMOSTHSMJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Oc1ccc2ccccc2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 10 | |
CAS#:3282-30-2
CAS#:135-19-3
CAS#:1538-75-6
CAS#:75-98-9
CAS#:612-55-5
CAS#:580-13-2
CAS#:14625-56-0
CAS#:91-58-7
CAS#:612-94-2
CAS#:93-09-4
CAS#:17626-88-9
CAS#:60718-19-6
CAS#:882-33-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanoic acid,2,2-dimethyl-,2-naphthalenyl ester |
| naphthalene-2-yl pivalate |
| naphthalen-7-yl pivalate |
| 2,2-Dimethylpropanoic acid,2-naphthyl ester |
| 2-naphthyl pivalate |
| 2-naphthyl 2,2,2-trimethylacetate |
| naphthalen-2-yl pivalate |
| pivalic acid-[2]naphthyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: Polar surface area (PSA) of naphthalen-2-yl 2,2-dimethylpropanoate is 26.30000. |
| Q: What is the InChIKey of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: InChIKey of naphthalen-2-yl 2,2-dimethylpropanoate is SUGMMMOSTHSMJT-UHFFFAOYSA-N. |
| Q: What are the upstream materials of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: Related upstream materials(CAS) of naphthalen-2-yl 2,2-dimethylpropanoate: 3282-30-2;135-19-3;1538-75-6;75-98-9. |
| Q: What are the downstream products of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: Related downstream products(CAS) of naphthalen-2-yl 2,2-dimethylpropanoate: 612-55-5;580-13-2;14625-56-0;91-58-7;612-94-2;93-09-4;17626-88-9;135-19-3;60718-19-6;882-33-7. |
| Q: What English synonyms does naphthalen-2-yl 2,2-dimethylpropanoate have? |
| A: English synonyms of naphthalen-2-yl 2,2-dimethylpropanoate: Propanoic acid,2,2-dimethyl-,2-naphthalenyl ester, naphthalene-2-yl pivalate, naphthalen-7-yl pivalate, 2,2-Dimethylpropanoic acid,2-naphthyl ester, 2-naphthyl pivalate, 2-naphthyl 2,2,2-trimethylacetate, naphthalen-2-yl pivalate, pivalic acid-[2]naphthyl ester. |
| Q: What is the Chinese name of 1503-86-2? |
| A: Chinese name of 1503-86-2 is 1503-86-2. |
| Q: What is the English name of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: The English name of naphthalen-2-yl 2,2-dimethylpropanoate is naphthalen-2-yl 2,2-dimethylpropanoate. |
| Q: What is the LogP of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: LogP of naphthalen-2-yl 2,2-dimethylpropanoate is 3.79130. |
| Q: What is the molecular weight of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: Molecular weight of naphthalen-2-yl 2,2-dimethylpropanoate is 228.28600. |
| Q: What is the molecular formula of naphthalen-2-yl 2,2-dimethylpropanoate? |
| A: Molecular formula of naphthalen-2-yl 2,2-dimethylpropanoate is C15H16O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |