5-Carboxytetramethylrhodamine structure
|
Common Name | 5-Carboxytetramethylrhodamine | ||
|---|---|---|---|---|
| CAS Number | 150322-05-7 | Molecular Weight | 430.453 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-Carboxytetramethylrhodamine5-Carboxytetramethylrhodamine can be used as a fluorescent probe of nucleic acids and proteins. 5-Carboxytetramethylrhodamine displays excitation maxima of 558 nm and an emission maximum of 586 nm[1][2][3]. |
| Name | 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Carboxytetramethylrhodamine can be used as a fluorescent probe of nucleic acids and proteins. 5-Carboxytetramethylrhodamine displays excitation maxima of 558 nm and an emission maximum of 586 nm[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H22N2O5 |
|---|---|
| Molecular Weight | 430.453 |
| Exact Mass | 430.152863 |
| PSA | 97.05000 |
| LogP | 3.72780 |
| InChIKey | DCVXPZDNLDPUES-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21OC(=O)c2cc(C(=O)O)ccc21 |
| Safety Phrases | 22-24/25 |
|---|
| 5-carboxy Tamra |
| 5-TAMRA |
| 5-carboxytetramethylrhodamine |
| Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(dimethylamino)-, inner salt |
| 2-[3,6-Bis(dimethylamino)-9-xantheniumyl]-5-carboxybenzoate |