1H-Indole, 3-phenyl- structure
|
Common Name | 1H-Indole, 3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1504-16-1 | Molecular Weight | 193.24400 | |
| Density | 1.156g/cm3 | Boiling Point | 394ºC at 760mmHg | |
| Molecular Formula | C14H11N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | 3-phenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760mmHg |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.24400 |
| Flash Point | 177.3ºC |
| Exact Mass | 193.08900 |
| PSA | 15.79000 |
| LogP | 3.83490 |
| Vapour Pressure | 4.64E-06mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | XZNGTBLWFCRXKR-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2c[nH]c3ccccc23)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Ph-indole |
| 3-phenyl-1H-indol |
| 3-Phenylindole |
| 1H-Indole,3-phenyl |
| 3-Phenyl-indol |