4,6-Dichloro-5-(2-methoxyphenoxy)-2,2-bipyrimidine structure
|
Common Name | 4,6-Dichloro-5-(2-methoxyphenoxy)-2,2-bipyrimidine | ||
|---|---|---|---|---|
| CAS Number | 150728-13-5 | Molecular Weight | 349.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 520.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C15H10Cl2N4O2 | Melting Point | 159 °C | |
| MSDS | N/A | Flash Point | 268.7±32.9 °C | |
| Name | 4,6-Dichloro-5-(2-Methoxyphenoxy)-2,2-Bipyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.7±60.0 °C at 760 mmHg |
| Melting Point | 159 °C |
| Molecular Formula | C15H10Cl2N4O2 |
| Molecular Weight | 349.172 |
| Flash Point | 268.7±32.9 °C |
| Exact Mass | 348.018066 |
| PSA | 70.02000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | IZGOBGVYADHVKH-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Oc1c(Cl)nc(-c2ncccn2)nc1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
|
~90%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: US2012/136015 A1, ; Page/Page column 7 ; |
|
~97%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: WO2013/57545 A1, ; Paragraph 14-15 ; |
|
~%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: WO2011/24056 A2, ; Page/Page column 20 ; |
|
~%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 5 p. 955 - 959 |
|
~%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: WO2011/24056 A2, ; |
|
~%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: WO2011/24056 A2, ; |
|
~%
4,6-Dichloro-5-... CAS#:150728-13-5 |
| Literature: WO2011/24056 A2, ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dichloro-5-(2-methoxyphenoxy)-2,2’-bipyrimidine |
| 4,6-Dichloro-5-(2-methoxyphenoxy)-2,2'-bipyrimidine |
| 4,6-Dichloro-5-(O-methoxyphenoxy)-2-(2-pyrimidinyl)pyrimidine |
| 2,2'-Bipyrimidine, 4,6-dichloro-5-(2-methoxyphenoxy)- |
| 4,6-Dichloro-5-(2-methoxyphenoxy)-2,2-bipyrimidine |
| 4,6-dichloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidine |