Dimethyl (2-methoxyphenoxy)malonate structure
|
Common Name | Dimethyl (2-methoxyphenoxy)malonate | ||
|---|---|---|---|---|
| CAS Number | 150726-89-9 | Molecular Weight | 254.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 320.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.4±23.8 °C | |
| Name | Dimethyl 2-(2-Methoxyphenoxy)Malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.5±27.0 °C at 760 mmHg |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.236 |
| Flash Point | 138.4±23.8 °C |
| Exact Mass | 254.079041 |
| PSA | 71.06000 |
| LogP | 0.89 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | SBUXKADXTZOBJV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Oc1ccccc1OC)C(=O)OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dimethyl 2-Methoxyphenoxymalonate |
| Dimethyl 2-(2-methoxyphenoxy)malonate |
| Dimethyl (2-methoxyphenoxy)malonate |
| Propanedioic acid, 2-(2-methoxyphenoxy)-, dimethyl ester |